C9H8Br2NO5S- — CID 156666415
2-(2-amino-3,5-dibromobenzoyl)oxyethanesulfonate (PubChem CID 156666415) has the molecular formula C9H8Br2NO5S- and a molecular weight of 402.04 g/mol. Its IUPAC name is 2-(2-amino-3,5-dibromobenzoyl)oxyethanesulfonate.
| Compound Name | 2-(2-amino-3,5-dibromobenzoyl)oxyethanesulfonate |
|---|---|
| PubChem CID | 156666415 |
| Molecular Formula | C9H8Br2NO5S- |
| Molecular Weight | 402.04 g/mol |
| Exact Mass | 399.85 |
| IUPAC Name | 2-(2-amino-3,5-dibromobenzoyl)oxyethanesulfonate |
| SMILES | Nc1c(Br)cc(Br)cc1C(=O)OCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H9Br2NO5S/c10-5-3-6(8(12)7(11)4-5)9(13)17-1-2-18(14,15)16/h3-4H,1-2,12H2,(H,14,15,16)/p-1 |
| InChIKey | GLZMHQVWJKHAJD-UHFFFAOYSA-M |
| XLogP | 1.50 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.04 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|