C7H6Br2N2O2 — CID 13097908
2-amino-3,5-dibromo-N-hydroxybenzamide (PubChem CID 13097908) has the molecular formula C7H6Br2N2O2 and a molecular weight of 309.95 g/mol. Its IUPAC name is 2-amino-3,5-dibromo-N-hydroxybenzamide.
| Compound Name | 2-amino-3,5-dibromo-N-hydroxybenzamide |
|---|---|
| PubChem CID | 13097908 |
| Molecular Formula | C7H6Br2N2O2 |
| Molecular Weight | 309.95 g/mol |
| Exact Mass | 307.88 |
| IUPAC Name | 2-amino-3,5-dibromo-N-hydroxybenzamide |
| SMILES | Nc1c(Br)cc(Br)cc1C(=O)NO |
| InChI | InChI=1S/C7H6Br2N2O2/c8-3-1-4(7(12)11-13)6(10)5(9)2-3/h1-2,13H,10H2,(H,11,12) |
| InChIKey | GNQLXRPOYIAZRV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.95 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|