C12H8Br2N2O — CID 12939592
(2-amino-3,5-dibromophenyl)-pyridin-2-ylmethanone (PubChem CID 12939592) has the molecular formula C12H8Br2N2O and a molecular weight of 356.02 g/mol. Its IUPAC name is (2-amino-3,5-dibromophenyl)-pyridin-2-ylmethanone.
| Compound Name | (2-amino-3,5-dibromophenyl)-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 12939592 |
| Molecular Formula | C12H8Br2N2O |
| Molecular Weight | 356.02 g/mol |
| Exact Mass | 353.90 |
| IUPAC Name | (2-amino-3,5-dibromophenyl)-pyridin-2-ylmethanone |
| SMILES | Nc1c(Br)cc(Br)cc1C(=O)c1ccccn1 |
| InChI | InChI=1S/C12H8Br2N2O/c13-7-5-8(11(15)9(14)6-7)12(17)10-3-1-2-4-16-10/h1-6H,15H2 |
| InChIKey | QNIJXRIQNRCDDN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.02 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|