About 3-bromobenzohydrazide;dipyridin-2-ylmethanone
3-bromobenzohydrazide;dipyridin-2-ylmethanone (PubChem CID 118467850) has the molecular formula C18H15BrN4O2
and a molecular weight of 399.25 g/mol. Its IUPAC name is 3-bromobenzohydrazide;dipyridin-2-ylmethanone.
Molecular Properties
| Compound Name | 3-bromobenzohydrazide;dipyridin-2-ylmethanone |
| PubChem CID | 118467850 |
| Molecular Formula | C18H15BrN4O2 |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 3-bromobenzohydrazide;dipyridin-2-ylmethanone |
| SMILES | NNC(=O)c1cccc(Br)c1.O=C(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C11H8N2O.C7H7BrN2O/c14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10;8-6-3-1-2-5(4-6)7(11)10-9/h1-8H;1-4H,9H2,(H,10,11) |
| InChIKey | DYRXFFMIVWXAGD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromobenzohydrazide;dipyridin-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromobenzohydrazide;dipyridin-2-ylmethanone?
The IUPAC name of 3-bromobenzohydrazide;dipyridin-2-ylmethanone (CID 118467850) is 3-bromobenzohydrazide;dipyridin-2-ylmethanone.
What is the SMILES notation for 3-bromobenzohydrazide;dipyridin-2-ylmethanone?
The canonical SMILES for 3-bromobenzohydrazide;dipyridin-2-ylmethanone is NNC(=O)c1cccc(Br)c1.O=C(c1ccccn1)c1ccccn1.
What is the InChIKey of 3-bromobenzohydrazide;dipyridin-2-ylmethanone?
The InChIKey is DYRXFFMIVWXAGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O.C7H7BrN2O/c14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10;8-6-3-1-2-5(4-6)7(11)10-9/h1-8H;1-4H,9H2,(H,10,11).
What are the key properties of 3-bromobenzohydrazide;dipyridin-2-ylmethanone?
3-bromobenzohydrazide;dipyridin-2-ylmethanone has a molecular weight of 399.25 g/mol, XLogP of 2.76, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromobenzohydrazide;dipyridin-2-ylmethanone is sourced from PubChem (CID 118467850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).