C12H14Br2N2O — CID 89420130
2-amino-3,5-dibromo-N-(1-cyclopropylethyl)benzamide (PubChem CID 89420130) has the molecular formula C12H14Br2N2O and a molecular weight of 362.07 g/mol. Its IUPAC name is 2-amino-3,5-dibromo-N-(1-cyclopropylethyl)benzamide.
| Compound Name | 2-amino-3,5-dibromo-N-(1-cyclopropylethyl)benzamide |
|---|---|
| PubChem CID | 89420130 |
| Molecular Formula | C12H14Br2N2O |
| Molecular Weight | 362.07 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | 2-amino-3,5-dibromo-N-(1-cyclopropylethyl)benzamide |
| SMILES | CC(NC(=O)c1cc(Br)cc(Br)c1N)C1CC1 |
| InChI | InChI=1S/C12H14Br2N2O/c1-6(7-2-3-7)16-12(17)9-4-8(13)5-10(14)11(9)15/h4-7H,2-3,15H2,1H3,(H,16,17) |
| InChIKey | LRCNFMBNIRWORQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.07 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|