C15H13Br2N3O2 — CID 51061307
2-amino-3,5-dibromo-N-[(E)-(2-methoxyphenyl)methylideneamino]benzamide (PubChem CID 51061307) has the molecular formula C15H13Br2N3O2 and a molecular weight of 427.10 g/mol. Its IUPAC name is 2-amino-3,5-dibromo-N-[(E)-(2-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 2-amino-3,5-dibromo-N-[(E)-(2-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 51061307 |
| Molecular Formula | C15H13Br2N3O2 |
| Molecular Weight | 427.10 g/mol |
| Exact Mass | 424.94 |
| IUPAC Name | 2-amino-3,5-dibromo-N-[(E)-(2-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccccc1/C=N/NC(=O)c1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C15H13Br2N3O2/c1-22-13-5-3-2-4-9(13)8-19-20-15(21)11-6-10(16)7-12(17)14(11)18/h2-8H,18H2,1H3,(H,20,21)/b19-8+ |
| InChIKey | YBMHNPLGERZEOF-UFWORHAWSA-N |
| XLogP | 3.57 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.10 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|