C15H13Br2N3O3 — CID 135606860
2-amino-3,5-dibromo-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]benzamide (PubChem CID 135606860) has the molecular formula C15H13Br2N3O3 and a molecular weight of 443.10 g/mol. Its IUPAC name is 2-amino-3,5-dibromo-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 2-amino-3,5-dibromo-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135606860 |
| Molecular Formula | C15H13Br2N3O3 |
| Molecular Weight | 443.10 g/mol |
| Exact Mass | 440.93 |
| IUPAC Name | 2-amino-3,5-dibromo-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cccc(/C=N/NC(=O)c2cc(Br)cc(Br)c2N)c1O |
| InChI | InChI=1S/C15H13Br2N3O3/c1-23-12-4-2-3-8(14(12)21)7-19-20-15(22)10-5-9(16)6-11(17)13(10)18/h2-7,21H,18H2,1H3,(H,20,22)/b19-7+ |
| InChIKey | QLNNWTPFUUHTRO-FBCYGCLPSA-N |
| XLogP | 3.27 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.10 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|