C14H11Br2N3O3 — CID 136782230
2-amino-3,5-dibromo-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]benzamide (PubChem CID 136782230) has the molecular formula C14H11Br2N3O3 and a molecular weight of 429.07 g/mol. Its IUPAC name is 2-amino-3,5-dibromo-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 2-amino-3,5-dibromo-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 136782230 |
| Molecular Formula | C14H11Br2N3O3 |
| Molecular Weight | 429.07 g/mol |
| Exact Mass | 426.92 |
| IUPAC Name | 2-amino-3,5-dibromo-N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]benzamide |
| SMILES | Nc1c(Br)cc(Br)cc1C(=O)N/N=C\c1ccc(O)cc1O |
| InChI | InChI=1S/C14H11Br2N3O3/c15-8-3-10(13(17)11(16)4-8)14(22)19-18-6-7-1-2-9(20)5-12(7)21/h1-6,20-21H,17H2,(H,19,22)/b18-6- |
| InChIKey | HHTGIEWTWDVYGT-FXBPXSCXSA-N |
| XLogP | 2.97 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.07 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|