C13H17Br2NO3 — CID 106448200
2-(2-methylpropoxy)ethyl 2-amino-3,5-dibromobenzoate (PubChem CID 106448200) has the molecular formula C13H17Br2NO3 and a molecular weight of 395.09 g/mol. Its IUPAC name is 2-(2-methylpropoxy)ethyl 2-amino-3,5-dibromobenzoate.
| Compound Name | 2-(2-methylpropoxy)ethyl 2-amino-3,5-dibromobenzoate |
|---|---|
| PubChem CID | 106448200 |
| Molecular Formula | C13H17Br2NO3 |
| Molecular Weight | 395.09 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | 2-(2-methylpropoxy)ethyl 2-amino-3,5-dibromobenzoate |
| SMILES | CC(C)COCCOC(=O)c1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C13H17Br2NO3/c1-8(2)7-18-3-4-19-13(17)10-5-9(14)6-11(15)12(10)16/h5-6,8H,3-4,7,16H2,1-2H3 |
| InChIKey | XQWUGEMUTOAEKO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.09 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|