C15H23NO3 — CID 106448067
2-(2-methylpropoxy)ethyl 5-amino-2,3-dimethylbenzoate (PubChem CID 106448067) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 2-(2-methylpropoxy)ethyl 5-amino-2,3-dimethylbenzoate.
| Compound Name | 2-(2-methylpropoxy)ethyl 5-amino-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 106448067 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2-(2-methylpropoxy)ethyl 5-amino-2,3-dimethylbenzoate |
| SMILES | Cc1cc(N)cc(C(=O)OCCOCC(C)C)c1C |
| InChI | InChI=1S/C15H23NO3/c1-10(2)9-18-5-6-19-15(17)14-8-13(16)7-11(3)12(14)4/h7-8,10H,5-6,9,16H2,1-4H3 |
| InChIKey | QHRHSSIYLKQKLR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|