C14H13Br3O7S — CID 158796227
2-methyl-2-[(E)-4-oxo-4-(2,4,6-tribromophenoxy)but-2-enoyl]oxypropane-1-sulfonic acid (PubChem CID 158796227) has the molecular formula C14H13Br3O7S and a molecular weight of 565.03 g/mol. Its IUPAC name is 2-methyl-2-[(E)-4-oxo-4-(2,4,6-tribromophenoxy)but-2-enoyl]oxypropane-1-sulfonic acid.
| Compound Name | 2-methyl-2-[(E)-4-oxo-4-(2,4,6-tribromophenoxy)but-2-enoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 158796227 |
| Molecular Formula | C14H13Br3O7S |
| Molecular Weight | 565.03 g/mol |
| Exact Mass | 561.79 |
| IUPAC Name | 2-methyl-2-[(E)-4-oxo-4-(2,4,6-tribromophenoxy)but-2-enoyl]oxypropane-1-sulfonic acid |
| SMILES | CC(C)(CS(=O)(=O)O)OC(=O)/C=C/C(=O)Oc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C14H13Br3O7S/c1-14(2,7-25(20,21)22)24-12(19)4-3-11(18)23-13-9(16)5-8(15)6-10(13)17/h3-6H,7H2,1-2H3,(H,20,21,22)/b4-3+ |
| InChIKey | FRKOKLCPISIKKF-ONEGZZNKSA-N |
| XLogP | 3.65 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.03 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|