C14H12Br3F3O7S — CID 157183476
3,3,3-trifluoro-2-[5-oxo-5-(2,4,6-tribromophenoxy)pentanoyl]oxypropane-1-sulfonic acid (PubChem CID 157183476) has the molecular formula C14H12Br3F3O7S and a molecular weight of 621.02 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[5-oxo-5-(2,4,6-tribromophenoxy)pentanoyl]oxypropane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-[5-oxo-5-(2,4,6-tribromophenoxy)pentanoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 157183476 |
| Molecular Formula | C14H12Br3F3O7S |
| Molecular Weight | 621.02 g/mol |
| Exact Mass | 617.78 |
| IUPAC Name | 3,3,3-trifluoro-2-[5-oxo-5-(2,4,6-tribromophenoxy)pentanoyl]oxypropane-1-sulfonic acid |
| SMILES | O=C(CCCC(=O)OC(CS(=O)(=O)O)C(F)(F)F)Oc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C14H12Br3F3O7S/c15-7-4-8(16)13(9(17)5-7)27-12(22)3-1-2-11(21)26-10(14(18,19)20)6-28(23,24)25/h4-5,10H,1-3,6H2,(H,23,24,25) |
| InChIKey | CLYYAAWKVZIWOM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.02 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|