C9H7Br3ClNO — CID 104513227
2-chloro-3-(2,4,6-tribromophenyl)propanamide (PubChem CID 104513227) has the molecular formula C9H7Br3ClNO and a molecular weight of 420.33 g/mol. Its IUPAC name is 2-chloro-3-(2,4,6-tribromophenyl)propanamide.
| Compound Name | 2-chloro-3-(2,4,6-tribromophenyl)propanamide |
|---|---|
| PubChem CID | 104513227 |
| Molecular Formula | C9H7Br3ClNO |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 416.78 |
| IUPAC Name | 2-chloro-3-(2,4,6-tribromophenyl)propanamide |
| SMILES | NC(=O)C(Cl)Cc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C9H7Br3ClNO/c10-4-1-6(11)5(7(12)2-4)3-8(13)9(14)15/h1-2,8H,3H2,(H2,14,15) |
| InChIKey | WFIIXQSJIFRWNV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|