C25H25F3O3 — CID 59482784
[2-methyl-4-(1-phenanthren-9-ylethoxy)butan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 59482784) has the molecular formula C25H25F3O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is [2-methyl-4-(1-phenanthren-9-ylethoxy)butan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [2-methyl-4-(1-phenanthren-9-ylethoxy)butan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 59482784 |
| Molecular Formula | C25H25F3O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | [2-methyl-4-(1-phenanthren-9-ylethoxy)butan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(C)CCOC(C)c1cc2ccccc2c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C25H25F3O3/c1-16(25(26,27)28)23(29)31-24(3,4)13-14-30-17(2)22-15-18-9-5-6-10-19(18)20-11-7-8-12-21(20)22/h5-12,15,17H,1,13-14H2,2-4H3 |
| InChIKey | SDLAHSCVCKOTNX-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|