C26H30O3 — CID 59482876
[3-ethyl-1-(1-phenanthren-2-ylethoxy)pentan-3-yl] prop-2-enoate (PubChem CID 59482876) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is [3-ethyl-1-(1-phenanthren-2-ylethoxy)pentan-3-yl] prop-2-enoate.
| Compound Name | [3-ethyl-1-(1-phenanthren-2-ylethoxy)pentan-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 59482876 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [3-ethyl-1-(1-phenanthren-2-ylethoxy)pentan-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(CC)(CC)CCOC(C)c1ccc2c(ccc3ccccc32)c1 |
| InChI | InChI=1S/C26H30O3/c1-5-25(27)29-26(6-2,7-3)16-17-28-19(4)21-14-15-24-22(18-21)13-12-20-10-8-9-11-23(20)24/h5,8-15,18-19H,1,6-7,16-17H2,2-4H3 |
| InChIKey | ABHPOIJRELECPX-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|