C43H64O14 — CID 54387350
[1,2,2,2-tetraethoxy-1-[4-[2-[4-[1,2,2,2-tetraethoxy-1-(2-methylprop-2-enoyloxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl] 2-methylprop-2-enoate (PubChem CID 54387350) has the molecular formula C43H64O14 and a molecular weight of 804.97 g/mol. Its IUPAC name is [1,2,2,2-tetraethoxy-1-[4-[2-[4-[1,2,2,2-tetraethoxy-1-(2-methylprop-2-enoyloxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl] 2-methylprop-2-enoate.
| Compound Name | [1,2,2,2-tetraethoxy-1-[4-[2-[4-[1,2,2,2-tetraethoxy-1-(2-methylprop-2-enoyloxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54387350 |
| Molecular Formula | C43H64O14 |
| Molecular Weight | 804.97 g/mol |
| Exact Mass | 804.43 |
| IUPAC Name | [1,2,2,2-tetraethoxy-1-[4-[2-[4-[1,2,2,2-tetraethoxy-1-(2-methylprop-2-enoyloxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(OCC)(Oc1ccc(C(C)(C)c2ccc(OC(OCC)(OC(=O)C(=C)C)C(OCC)(OCC)OCC)cc2)cc1)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C43H64O14/c1-15-46-40(47-16-2,48-17-3)42(52-21-7,56-37(44)31(9)10)54-35-27-23-33(24-28-35)39(13,14)34-25-29-36(30-26-34)55-43(53-22-8,57-38(45)32(11)12)41(49-18-4,50-19-5)51-20-6/h23-30H,9,11,15-22H2,1-8,10,12-14H3 |
| InChIKey | VEECILSYVQXGJZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.97 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|