C13H18O10S — CID 87585712
(2R,3S,5R)-2,3,4,4,5-pentahydroxy-6-(4-methylphenyl)sulfonyloxyhexanoic acid (PubChem CID 87585712) has the molecular formula C13H18O10S and a molecular weight of 366.34 g/mol. Its IUPAC name is (2R,3S,5R)-2,3,4,4,5-pentahydroxy-6-(4-methylphenyl)sulfonyloxyhexanoic acid.
| Compound Name | (2R,3S,5R)-2,3,4,4,5-pentahydroxy-6-(4-methylphenyl)sulfonyloxyhexanoic acid |
|---|---|
| PubChem CID | 87585712 |
| Molecular Formula | C13H18O10S |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (2R,3S,5R)-2,3,4,4,5-pentahydroxy-6-(4-methylphenyl)sulfonyloxyhexanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)C(O)(O)[C@@H](O)[C@@H](O)C(=O)O)cc1 |
| InChI | InChI=1S/C13H18O10S/c1-7-2-4-8(5-3-7)24(21,22)23-6-9(14)13(19,20)11(16)10(15)12(17)18/h2-5,9-11,14-16,19-20H,6H2,1H3,(H,17,18)/t9-,10-,11+/m1/s1 |
| InChIKey | YGWYHWDVRCGPRX-MXWKQRLJSA-N |
| XLogP | -2.45 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|