C22H36O3S — CID 11326547
(1,1-dideuterio-3,7,11-trimethyldodec-10-enyl) 4-methylbenzenesulfonate (PubChem CID 11326547) has the molecular formula C22H36O3S and a molecular weight of 382.61 g/mol. Its IUPAC name is (1,1-dideuterio-3,7,11-trimethyldodec-10-enyl) 4-methylbenzenesulfonate.
| Compound Name | (1,1-dideuterio-3,7,11-trimethyldodec-10-enyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11326547 |
| Molecular Formula | C22H36O3S |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (1,1-dideuterio-3,7,11-trimethyldodec-10-enyl) 4-methylbenzenesulfonate |
| SMILES | [2H]C([2H])(CC(C)CCCC(C)CCC=C(C)C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H36O3S/c1-18(2)8-6-9-19(3)10-7-11-20(4)16-17-25-26(23,24)22-14-12-21(5)13-15-22/h8,12-15,19-20H,6-7,9-11,16-17H2,1-5H3/i17D2 |
| InChIKey | UFUZLPPSCIHKLG-FBCWWBABSA-N |
| XLogP | 6.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|