C22H42O8SSi3 — CID 171125071
[(2R,3R,4S,5R,6S)-6-hydroxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 171125071) has the molecular formula C22H42O8SSi3 and a molecular weight of 550.90 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-hydroxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-hydroxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171125071 |
| Molecular Formula | C22H42O8SSi3 |
| Molecular Weight | 550.90 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-hydroxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C22H42O8SSi3/c1-16-11-13-17(14-12-16)31(24,25)26-15-18-19(28-32(2,3)4)20(29-33(5,6)7)21(22(23)27-18)30-34(8,9)10/h11-14,18-23H,15H2,1-10H3/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | QLHDRRHVZLBJLG-BDHVOXNPSA-N |
| XLogP | 4.08 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|