C35H47O10PSi — CID 11115123
[(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-diethoxyphosphanyloxyoxolan-3-yl] 3,4,5-trimethoxybenzoate (PubChem CID 11115123) has the molecular formula C35H47O10PSi and a molecular weight of 686.81 g/mol. Its IUPAC name is [(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-diethoxyphosphanyloxyoxolan-3-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-diethoxyphosphanyloxyoxolan-3-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 11115123 |
| Molecular Formula | C35H47O10PSi |
| Molecular Weight | 686.81 g/mol |
| Exact Mass | 686.27 |
| IUPAC Name | [(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-diethoxyphosphanyloxyoxolan-3-yl] 3,4,5-trimethoxybenzoate |
| SMILES | CCOP(OCC)OC1C[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C35H47O10PSi/c1-9-40-46(41-10-2)45-32-23-28(44-34(36)25-21-29(37-6)33(39-8)30(22-25)38-7)31(43-32)24-42-47(35(3,4)5,26-17-13-11-14-18-26)27-19-15-12-16-20-27/h11-22,28,31-32H,9-10,23-24H2,1-8H3/t28-,31+,32?/m0/s1 |
| InChIKey | GWSVCEAGSIMFKA-KBIZUEHRSA-N |
| XLogP | 6.25 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.81 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|