C48H49NO8SSi — CID 10795564
[(2R,3S,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(1,3-dioxoisoindol-2-yl)-6-ethylsulfanyl-4-(4-methylbenzoyl)oxyoxan-3-yl] 4-methylbenzoate (PubChem CID 10795564) has the molecular formula C48H49NO8SSi and a molecular weight of 828.07 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(1,3-dioxoisoindol-2-yl)-6-ethylsulfanyl-4-(4-methylbenzoyl)oxyoxan-3-yl] 4-methylbenzoate.
| Compound Name | [(2R,3S,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(1,3-dioxoisoindol-2-yl)-6-ethylsulfanyl-4-(4-methylbenzoyl)oxyoxan-3-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 10795564 |
| Molecular Formula | C48H49NO8SSi |
| Molecular Weight | 828.07 g/mol |
| Exact Mass | 827.29 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(1,3-dioxoisoindol-2-yl)-6-ethylsulfanyl-4-(4-methylbenzoyl)oxyoxan-3-yl] 4-methylbenzoate |
| SMILES | CCS[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OC(=O)c2ccc(C)cc2)[C@H](OC(=O)c2ccc(C)cc2)[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C48H49NO8SSi/c1-7-58-47-40(49-43(50)37-20-14-15-21-38(37)44(49)51)42(57-46(53)34-28-24-32(3)25-29-34)41(56-45(52)33-26-22-31(2)23-27-33)39(55-47)30-54-59(48(4,5)6,35-16-10-8-11-17-35)36-18-12-9-13-19-36/h8-29,39-42,47H,7,30H2,1-6H3/t39-,40-,41-,42-,47+/m1/s1 |
| InChIKey | ZTPQFNDSYBUWCR-WLVMQXKJSA-N |
| XLogP | 7.77 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.07 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|