C20H23NO8S — CID 140516810
[(3R,4R,5S)-4-acetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-ethylsulfanyl-2-(hydroxymethyl)oxan-3-yl] acetate (PubChem CID 140516810) has the molecular formula C20H23NO8S and a molecular weight of 437.47 g/mol. Its IUPAC name is [(3R,4R,5S)-4-acetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-ethylsulfanyl-2-(hydroxymethyl)oxan-3-yl] acetate.
| Compound Name | [(3R,4R,5S)-4-acetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-ethylsulfanyl-2-(hydroxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 140516810 |
| Molecular Formula | C20H23NO8S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | [(3R,4R,5S)-4-acetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-ethylsulfanyl-2-(hydroxymethyl)oxan-3-yl] acetate |
| SMILES | CCSC1OC(CO)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H23NO8S/c1-4-30-20-15(21-18(25)12-7-5-6-8-13(12)19(21)26)17(28-11(3)24)16(27-10(2)23)14(9-22)29-20/h5-8,14-17,20,22H,4,9H2,1-3H3/t14?,15-,16-,17+,20?/m0/s1 |
| InChIKey | ZWYRFSXHUAKMHD-FVTKVJNCSA-N |
| XLogP | 0.98 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|