C29H26FNO7S — CID 72947837
[(2S,3R,4R,5S,6R)-3-(1,3-dioxoisoindol-2-yl)-2-(4-fluorophenyl)sulfanyl-6-(hydroxymethyl)-5-phenylmethoxyoxan-4-yl] acetate (PubChem CID 72947837) has the molecular formula C29H26FNO7S and a molecular weight of 551.59 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-3-(1,3-dioxoisoindol-2-yl)-2-(4-fluorophenyl)sulfanyl-6-(hydroxymethyl)-5-phenylmethoxyoxan-4-yl] acetate.
| Compound Name | [(2S,3R,4R,5S,6R)-3-(1,3-dioxoisoindol-2-yl)-2-(4-fluorophenyl)sulfanyl-6-(hydroxymethyl)-5-phenylmethoxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 72947837 |
| Molecular Formula | C29H26FNO7S |
| Molecular Weight | 551.59 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-3-(1,3-dioxoisoindol-2-yl)-2-(4-fluorophenyl)sulfanyl-6-(hydroxymethyl)-5-phenylmethoxyoxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OCc2ccccc2)[C@@H](CO)O[C@@H](Sc2ccc(F)cc2)[C@@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H26FNO7S/c1-17(33)37-26-24(31-27(34)21-9-5-6-10-22(21)28(31)35)29(39-20-13-11-19(30)12-14-20)38-23(15-32)25(26)36-16-18-7-3-2-4-8-18/h2-14,23-26,29,32H,15-16H2,1H3/t23-,24-,25-,26-,29+/m1/s1 |
| InChIKey | KGVFHMRJFDFUSL-FSJVOCHISA-N |
| XLogP | 3.82 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|