C19H23NO6S — CID 101187105
2-[(2S,3R,4R,5S,6R)-2-ethylsulfanyl-5-hydroxy-6-(hydroxymethyl)-4-prop-2-enoxyoxan-3-yl]isoindole-1,3-dione (PubChem CID 101187105) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5S,6R)-2-ethylsulfanyl-5-hydroxy-6-(hydroxymethyl)-4-prop-2-enoxyoxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3R,4R,5S,6R)-2-ethylsulfanyl-5-hydroxy-6-(hydroxymethyl)-4-prop-2-enoxyoxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 101187105 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[(2S,3R,4R,5S,6R)-2-ethylsulfanyl-5-hydroxy-6-(hydroxymethyl)-4-prop-2-enoxyoxan-3-yl]isoindole-1,3-dione |
| SMILES | C=CCO[C@H]1[C@H](O)[C@@H](CO)O[C@@H](SCC)[C@@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H23NO6S/c1-3-9-25-16-14(19(27-4-2)26-13(10-21)15(16)22)20-17(23)11-7-5-6-8-12(11)18(20)24/h3,5-8,13-16,19,21-22H,1,4,9-10H2,2H3/t13-,14-,15-,16-,19+/m1/s1 |
| InChIKey | SBIMFLXMULDCQD-HLTONANMSA-N |
| XLogP | 1.05 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|