C31H31NO7 — CID 67359191
2-[(2R,3R,4R,5S,6R)-6-(hydroxymethyl)-2,5-bis(phenylmethoxy)-4-prop-2-enoxyoxan-3-yl]isoindole-1,3-dione (PubChem CID 67359191) has the molecular formula C31H31NO7 and a molecular weight of 529.59 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5S,6R)-6-(hydroxymethyl)-2,5-bis(phenylmethoxy)-4-prop-2-enoxyoxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,3R,4R,5S,6R)-6-(hydroxymethyl)-2,5-bis(phenylmethoxy)-4-prop-2-enoxyoxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67359191 |
| Molecular Formula | C31H31NO7 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 2-[(2R,3R,4R,5S,6R)-6-(hydroxymethyl)-2,5-bis(phenylmethoxy)-4-prop-2-enoxyoxan-3-yl]isoindole-1,3-dione |
| SMILES | C=CCO[C@H]1[C@H](OCc2ccccc2)[C@@H](CO)O[C@@H](OCc2ccccc2)[C@@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C31H31NO7/c1-2-17-36-28-26(32-29(34)23-15-9-10-16-24(23)30(32)35)31(38-20-22-13-7-4-8-14-22)39-25(18-33)27(28)37-19-21-11-5-3-6-12-21/h2-16,25-28,31,33H,1,17-20H2/t25-,26-,27-,28-,31-/m1/s1 |
| InChIKey | MDXAUYHMDFMYMI-WQBXQMBKSA-N |
| XLogP | 3.74 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|