C25H35NO8Si — CID 11191365
[(2R,3S,4R,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(1,3-dioxoisoindol-2-yl)-3-hydroxy-6-prop-2-enoxyoxan-4-yl] acetate (PubChem CID 11191365) has the molecular formula C25H35NO8Si and a molecular weight of 505.64 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(1,3-dioxoisoindol-2-yl)-3-hydroxy-6-prop-2-enoxyoxan-4-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(1,3-dioxoisoindol-2-yl)-3-hydroxy-6-prop-2-enoxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 11191365 |
| Molecular Formula | C25H35NO8Si |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(1,3-dioxoisoindol-2-yl)-3-hydroxy-6-prop-2-enoxyoxan-4-yl] acetate |
| SMILES | C=CCO[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](OC(C)=O)[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H35NO8Si/c1-8-13-31-24-19(26-22(29)16-11-9-10-12-17(16)23(26)30)21(33-15(2)27)20(28)18(34-24)14-32-35(6,7)25(3,4)5/h8-12,18-21,24,28H,1,13-14H2,2-7H3/t18-,19-,20-,21-,24-/m1/s1 |
| InChIKey | JVPOPMHZGKCYFN-UNNUSUAFSA-N |
| XLogP | 2.89 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|