C28H29IO5 — CID 15331362
(2S,3R,4S,5S)-5-[(2-iodophenyl)methoxy]-2-methoxy-6-methylidene-3,4-bis(phenylmethoxy)oxane (PubChem CID 15331362) has the molecular formula C28H29IO5 and a molecular weight of 572.44 g/mol. Its IUPAC name is (2S,3R,4S,5S)-5-[(2-iodophenyl)methoxy]-2-methoxy-6-methylidene-3,4-bis(phenylmethoxy)oxane.
| Compound Name | (2S,3R,4S,5S)-5-[(2-iodophenyl)methoxy]-2-methoxy-6-methylidene-3,4-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 15331362 |
| Molecular Formula | C28H29IO5 |
| Molecular Weight | 572.44 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | (2S,3R,4S,5S)-5-[(2-iodophenyl)methoxy]-2-methoxy-6-methylidene-3,4-bis(phenylmethoxy)oxane |
| SMILES | C=C1O[C@H](OC)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1I |
| InChI | InChI=1S/C28H29IO5/c1-20-25(33-19-23-15-9-10-16-24(23)29)26(31-17-21-11-5-3-6-12-21)27(28(30-2)34-20)32-18-22-13-7-4-8-14-22/h3-16,25-28H,1,17-19H2,2H3/t25-,26+,27-,28+/m1/s1 |
| InChIKey | JKVXOBGYDIJPAZ-GCFVYEKYSA-N |
| XLogP | 5.86 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.44 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|