C33H32O4Se — CID 135050696
(3S,4S,5R,6R)-2-methylidene-3,4,5-tris(phenylmethoxy)-6-phenylselanyloxane (PubChem CID 135050696) has the molecular formula C33H32O4Se and a molecular weight of 571.58 g/mol. Its IUPAC name is (3S,4S,5R,6R)-2-methylidene-3,4,5-tris(phenylmethoxy)-6-phenylselanyloxane.
| Compound Name | (3S,4S,5R,6R)-2-methylidene-3,4,5-tris(phenylmethoxy)-6-phenylselanyloxane |
|---|---|
| PubChem CID | 135050696 |
| Molecular Formula | C33H32O4Se |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | (3S,4S,5R,6R)-2-methylidene-3,4,5-tris(phenylmethoxy)-6-phenylselanyloxane |
| SMILES | C=C1O[C@H]([Se]c2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H32O4Se/c1-25-30(34-22-26-14-6-2-7-15-26)31(35-23-27-16-8-3-9-17-27)32(36-24-28-18-10-4-11-19-28)33(37-25)38-29-20-12-5-13-21-29/h2-21,30-33H,1,22-24H2/t30-,31+,32-,33-/m1/s1 |
| InChIKey | PUWMSIKYXLAAHX-VBWFMVIDSA-N |
| XLogP | 5.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|