C19H22O5Se — CID 11004110
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4-phenylmethoxy-6-phenylselanyloxane-3,5-diol (PubChem CID 11004110) has the molecular formula C19H22O5Se and a molecular weight of 409.34 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4-phenylmethoxy-6-phenylselanyloxane-3,5-diol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4-phenylmethoxy-6-phenylselanyloxane-3,5-diol |
|---|---|
| PubChem CID | 11004110 |
| Molecular Formula | C19H22O5Se |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4-phenylmethoxy-6-phenylselanyloxane-3,5-diol |
| SMILES | OC[C@H]1O[C@@H]([Se]c2ccccc2)[C@H](O)[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C19H22O5Se/c20-11-15-16(21)18(23-12-13-7-3-1-4-8-13)17(22)19(24-15)25-14-9-5-2-6-10-14/h1-10,15-22H,11-12H2/t15-,16-,17-,18+,19+/m1/s1 |
| InChIKey | HIZXNDXGNQDWGL-QQXKLLMISA-N |
| XLogP | 0.04 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|