C23H30O4 — CID 58510389
(2S,3S,4S,5R,6S)-2-methoxy-5,6-dimethyl-3,4-bis(phenylmethoxy)oxepane (PubChem CID 58510389) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-2-methoxy-5,6-dimethyl-3,4-bis(phenylmethoxy)oxepane.
| Compound Name | (2S,3S,4S,5R,6S)-2-methoxy-5,6-dimethyl-3,4-bis(phenylmethoxy)oxepane |
|---|---|
| PubChem CID | 58510389 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (2S,3S,4S,5R,6S)-2-methoxy-5,6-dimethyl-3,4-bis(phenylmethoxy)oxepane |
| SMILES | CO[C@H]1OC[C@@H](C)[C@@H](C)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H30O4/c1-17-14-27-23(24-3)22(26-16-20-12-8-5-9-13-20)21(18(17)2)25-15-19-10-6-4-7-11-19/h4-13,17-18,21-23H,14-16H2,1-3H3/t17-,18-,21+,22+,23+/m1/s1 |
| InChIKey | FNPGZAWXPYXYIG-JGOTUQMDSA-N |
| XLogP | 4.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |