C19H26F6O5 — CID 101365651
[(2S,3S,5R)-2-pentyl-5-[(1R)-1-(2,2,2-trifluoroacetyl)oxyhex-5-enyl]oxolan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 101365651) has the molecular formula C19H26F6O5 and a molecular weight of 448.40 g/mol. Its IUPAC name is [(2S,3S,5R)-2-pentyl-5-[(1R)-1-(2,2,2-trifluoroacetyl)oxyhex-5-enyl]oxolan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S,3S,5R)-2-pentyl-5-[(1R)-1-(2,2,2-trifluoroacetyl)oxyhex-5-enyl]oxolan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 101365651 |
| Molecular Formula | C19H26F6O5 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | [(2S,3S,5R)-2-pentyl-5-[(1R)-1-(2,2,2-trifluoroacetyl)oxyhex-5-enyl]oxolan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | C=CCCC[C@@H](OC(=O)C(F)(F)F)[C@H]1C[C@H](OC(=O)C(F)(F)F)[C@H](CCCCC)O1 |
| InChI | InChI=1S/C19H26F6O5/c1-3-5-7-9-12-15(30-17(27)19(23,24)25)11-14(28-12)13(10-8-6-4-2)29-16(26)18(20,21)22/h4,12-15H,2-3,5-11H2,1H3/t12-,13+,14+,15-/m0/s1 |
| InChIKey | XVICTMMZOMIIAG-YJNKXOJESA-N |
| XLogP | 5.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|