C15H30O5 — CID 71267956
3-[5-(1-hydroxypropyl)-2-pentyloxolan-3-yl]oxypropane-1,2-diol (PubChem CID 71267956) has the molecular formula C15H30O5 and a molecular weight of 290.40 g/mol. Its IUPAC name is 3-[5-(1-hydroxypropyl)-2-pentyloxolan-3-yl]oxypropane-1,2-diol.
| Compound Name | 3-[5-(1-hydroxypropyl)-2-pentyloxolan-3-yl]oxypropane-1,2-diol |
|---|---|
| PubChem CID | 71267956 |
| Molecular Formula | C15H30O5 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 3-[5-(1-hydroxypropyl)-2-pentyloxolan-3-yl]oxypropane-1,2-diol |
| SMILES | CCCCCC1OC(C(O)CC)CC1OCC(O)CO |
| InChI | InChI=1S/C15H30O5/c1-3-5-6-7-13-15(19-10-11(17)9-16)8-14(20-13)12(18)4-2/h11-18H,3-10H2,1-2H3 |
| InChIKey | KYCOQXPEECJZJI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|