C18H40O5 — CID 143470702
ethane;hexane;3-[5-(1-hydroxyethyl)-2-methyloxolan-3-yl]oxypropane-1,2-diol (PubChem CID 143470702) has the molecular formula C18H40O5 and a molecular weight of 336.51 g/mol. Its IUPAC name is ethane;hexane;3-[5-(1-hydroxyethyl)-2-methyloxolan-3-yl]oxypropane-1,2-diol.
| Compound Name | ethane;hexane;3-[5-(1-hydroxyethyl)-2-methyloxolan-3-yl]oxypropane-1,2-diol |
|---|---|
| PubChem CID | 143470702 |
| Molecular Formula | C18H40O5 |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.29 |
| IUPAC Name | ethane;hexane;3-[5-(1-hydroxyethyl)-2-methyloxolan-3-yl]oxypropane-1,2-diol |
| SMILES | CC.CC(O)C1CC(OCC(O)CO)C(C)O1.CCCCCC |
| InChI | InChI=1S/C10H20O5.C6H14.C2H6/c1-6(12)9-3-10(7(2)15-9)14-5-8(13)4-11;1-3-5-6-4-2;1-2/h6-13H,3-5H2,1-2H3;3-6H2,1-2H3;1-2H3 |
| InChIKey | XXDCDEUPRRZGMJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|