C24H31NO3Si — CID 101036860
(2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethoxy-2,6-dihydro-1H-pyridin-3-one (PubChem CID 101036860) has the molecular formula C24H31NO3Si and a molecular weight of 409.60 g/mol. Its IUPAC name is (2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethoxy-2,6-dihydro-1H-pyridin-3-one.
| Compound Name | (2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethoxy-2,6-dihydro-1H-pyridin-3-one |
|---|---|
| PubChem CID | 101036860 |
| Molecular Formula | C24H31NO3Si |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethoxy-2,6-dihydro-1H-pyridin-3-one |
| SMILES | CCO[C@H]1C=CC(=O)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1 |
| InChI | InChI=1S/C24H31NO3Si/c1-5-27-23-17-16-22(26)21(25-23)18-28-29(24(2,3)4,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-17,21,23,25H,5,18H2,1-4H3/t21-,23-/m0/s1 |
| InChIKey | LYSTVGFZJDVSAM-GMAHTHKFSA-N |
| XLogP | 3.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|