C32H39NO4Si — CID 69265121
ethyl 1-[[tert-butyl(diphenyl)silyl]oxymethyl]spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxylate (PubChem CID 69265121) has the molecular formula C32H39NO4Si and a molecular weight of 529.75 g/mol. Its IUPAC name is ethyl 1-[[tert-butyl(diphenyl)silyl]oxymethyl]spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxylate.
| Compound Name | ethyl 1-[[tert-butyl(diphenyl)silyl]oxymethyl]spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 69265121 |
| Molecular Formula | C32H39NO4Si |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | ethyl 1-[[tert-butyl(diphenyl)silyl]oxymethyl]spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxylate |
| SMILES | CCOC(=O)N1CCC2(CC1)OC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C32H39NO4Si/c1-5-35-30(34)33-22-20-32(21-23-33)28-19-13-12-18-27(28)29(37-32)24-36-38(31(2,3)4,25-14-8-6-9-15-25)26-16-10-7-11-17-26/h6-19,29H,5,20-24H2,1-4H3 |
| InChIKey | LPCSICMZUAUMMF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|