C15H18NO3- — CID 91666200
1-ethylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxylate (PubChem CID 91666200) has the molecular formula C15H18NO3- and a molecular weight of 260.31 g/mol. Its IUPAC name is 1-ethylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxylate.
| Compound Name | 1-ethylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 91666200 |
| Molecular Formula | C15H18NO3- |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-ethylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxylate |
| SMILES | CCC1OC2(CCN(C(=O)[O-])CC2)c2ccccc21 |
| InChI | InChI=1S/C15H19NO3/c1-2-13-11-5-3-4-6-12(11)15(19-13)7-9-16(10-8-15)14(17)18/h3-6,13H,2,7-10H2,1H3,(H,17,18)/p-1 |
| InChIKey | IXJJRONYDMHCRR-UHFFFAOYSA-M |
| XLogP | 1.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |