C38H43NO5SeSi — CID 10556664
benzyl (4S,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethenyl-2-(phenylseleninylmethyl)-1,3-oxazinane-3-carboxylate (PubChem CID 10556664) has the molecular formula C38H43NO5SeSi and a molecular weight of 700.81 g/mol. Its IUPAC name is benzyl (4S,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethenyl-2-(phenylseleninylmethyl)-1,3-oxazinane-3-carboxylate.
| Compound Name | benzyl (4S,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethenyl-2-(phenylseleninylmethyl)-1,3-oxazinane-3-carboxylate |
|---|---|
| PubChem CID | 10556664 |
| Molecular Formula | C38H43NO5SeSi |
| Molecular Weight | 700.81 g/mol |
| Exact Mass | 701.21 |
| IUPAC Name | benzyl (4S,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethenyl-2-(phenylseleninylmethyl)-1,3-oxazinane-3-carboxylate |
| SMILES | C=C[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)OCc2ccccc2)C(C[Se](=O)c2ccccc2)O1 |
| InChI | InChI=1S/C38H43NO5SeSi/c1-5-32-26-31(28-43-46(38(2,3)4,34-22-14-8-15-23-34)35-24-16-9-17-25-35)39(37(40)42-27-30-18-10-6-11-19-30)36(44-32)29-45(41)33-20-12-7-13-21-33/h5-25,31-32,36H,1,26-29H2,2-4H3/t31-,32+,36?,45?/m0/s1 |
| InChIKey | QHFRBAUMAXYNNE-WJZFINNBSA-N |
| XLogP | 6.20 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.81 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|