C24H30ClIOSi — CID 58139537
tert-butyl-[(1Z,4S,6E)-7-chloro-1-iodoocta-1,6-dien-4-yl]oxy-diphenylsilane (PubChem CID 58139537) has the molecular formula C24H30ClIOSi and a molecular weight of 524.95 g/mol. Its IUPAC name is tert-butyl-[(1Z,4S,6E)-7-chloro-1-iodoocta-1,6-dien-4-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(1Z,4S,6E)-7-chloro-1-iodoocta-1,6-dien-4-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 58139537 |
| Molecular Formula | C24H30ClIOSi |
| Molecular Weight | 524.95 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | tert-butyl-[(1Z,4S,6E)-7-chloro-1-iodoocta-1,6-dien-4-yl]oxy-diphenylsilane |
| SMILES | C/C(Cl)=C\C[C@@H](C/C=C\I)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H30ClIOSi/c1-20(25)17-18-21(12-11-19-26)27-28(24(2,3)4,22-13-7-5-8-14-22)23-15-9-6-10-16-23/h5-11,13-17,19,21H,12,18H2,1-4H3/b19-11-,20-17+/t21-/m1/s1 |
| InChIKey | RJAUCWGFYZEBMX-KKKSMDSDSA-N |
| XLogP | 6.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.95 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|