C12H16F3NO3S2 — CID 101362516
[(2S)-3-(2-phenylethylamino)-2-sulfanylpropyl] trifluoromethanesulfonate (PubChem CID 101362516) has the molecular formula C12H16F3NO3S2 and a molecular weight of 343.39 g/mol. Its IUPAC name is [(2S)-3-(2-phenylethylamino)-2-sulfanylpropyl] trifluoromethanesulfonate.
| Compound Name | [(2S)-3-(2-phenylethylamino)-2-sulfanylpropyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101362516 |
| Molecular Formula | C12H16F3NO3S2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | [(2S)-3-(2-phenylethylamino)-2-sulfanylpropyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC[C@@H](S)CNCCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO3S2/c13-12(14,15)21(17,18)19-9-11(20)8-16-7-6-10-4-2-1-3-5-10/h1-5,11,16,20H,6-9H2/t11-/m0/s1 |
| InChIKey | SDSOJXFIJMICNO-NSHDSACASA-N |
| XLogP | 1.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|