C12H15F2O6S+ — CID 162084924
methyl 1,1-difluoro-2-[2-hydroxy-2-(4-methoxyphenyl)ethoxy]ethanesulfonate (PubChem CID 162084924) has the molecular formula C12H15F2O6S+ and a molecular weight of 325.31 g/mol. Its IUPAC name is methyl 1,1-difluoro-2-[2-hydroxy-2-(4-methoxyphenyl)ethoxy]ethanesulfonate.
| Compound Name | methyl 1,1-difluoro-2-[2-hydroxy-2-(4-methoxyphenyl)ethoxy]ethanesulfonate |
|---|---|
| PubChem CID | 162084924 |
| Molecular Formula | C12H15F2O6S+ |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | methyl 1,1-difluoro-2-[2-hydroxy-2-(4-methoxyphenyl)ethoxy]ethanesulfonate |
| SMILES | [CH2+]OS(=O)(=O)C(F)(F)COCC(O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C12H15F2O6S/c1-18-10-5-3-9(4-6-10)11(15)7-20-8-12(13,14)21(16,17)19-2/h3-6,11,15H,2,7-8H2,1H3/q+1 |
| InChIKey | SWBGFXPIDSEBBO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|