C21H24O3 — CID 175615948
[2-(2,6-dimethylphenyl)-2-oxoethyl] 4-butan-2-ylbenzoate (PubChem CID 175615948) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is [2-(2,6-dimethylphenyl)-2-oxoethyl] 4-butan-2-ylbenzoate.
| Compound Name | [2-(2,6-dimethylphenyl)-2-oxoethyl] 4-butan-2-ylbenzoate |
|---|---|
| PubChem CID | 175615948 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [2-(2,6-dimethylphenyl)-2-oxoethyl] 4-butan-2-ylbenzoate |
| SMILES | CCC(C)c1ccc(C(=O)OCC(=O)c2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C21H24O3/c1-5-14(2)17-9-11-18(12-10-17)21(23)24-13-19(22)20-15(3)7-6-8-16(20)4/h6-12,14H,5,13H2,1-4H3 |
| InChIKey | CQGBYUWOZDTAKY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |