C12H14O3 — CID 146006483
[2-(2,6-dimethylphenyl)-2-oxoethyl] acetate (PubChem CID 146006483) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is [2-(2,6-dimethylphenyl)-2-oxoethyl] acetate.
| Compound Name | [2-(2,6-dimethylphenyl)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 146006483 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | [2-(2,6-dimethylphenyl)-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)c1c(C)cccc1C |
| InChI | InChI=1S/C12H14O3/c1-8-5-4-6-9(2)12(8)11(14)7-15-10(3)13/h4-6H,7H2,1-3H3 |
| InChIKey | DKBOFIBROLDFEW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |