C24H30N2O4 — CID 8914880
[2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate (PubChem CID 8914880) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is [2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate.
| Compound Name | [2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
|---|---|
| PubChem CID | 8914880 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | [2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
| SMILES | CC[C@H](C)c1ccc(C(=O)COC(=O)c2ccc(CNC(=O)NC(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-5-17(4)19-10-12-20(13-11-19)22(27)15-30-23(28)21-8-6-18(7-9-21)14-25-24(29)26-16(2)3/h6-13,16-17H,5,14-15H2,1-4H3,(H2,25,26,29)/t17-/m0/s1 |
| InChIKey | NSLCNMPJYMOYSQ-KRWDZBQOSA-N |
| XLogP | 4.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |