C13H21N2O5P — CID 10567392
ethyl 2-[[ethoxy-(4-methoxyanilino)phosphoryl]amino]acetate (PubChem CID 10567392) has the molecular formula C13H21N2O5P and a molecular weight of 316.29 g/mol. Its IUPAC name is ethyl 2-[[ethoxy-(4-methoxyanilino)phosphoryl]amino]acetate.
| Compound Name | ethyl 2-[[ethoxy-(4-methoxyanilino)phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 10567392 |
| Molecular Formula | C13H21N2O5P |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | ethyl 2-[[ethoxy-(4-methoxyanilino)phosphoryl]amino]acetate |
| SMILES | CCOC(=O)CNP(=O)(Nc1ccc(OC)cc1)OCC |
| InChI | InChI=1S/C13H21N2O5P/c1-4-19-13(16)10-14-21(17,20-5-2)15-11-6-8-12(18-3)9-7-11/h6-9H,4-5,10H2,1-3H3,(H2,14,15,17) |
| InChIKey | LVZVERWRANGKBT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|