C20H29NO3 — CID 123808598
[2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl pyrrolidine-3-carboxylate (PubChem CID 123808598) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl pyrrolidine-3-carboxylate.
| Compound Name | [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 123808598 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | [2-(1-cyclopropylethyl)-6-propan-2-ylphenoxy]methyl pyrrolidine-3-carboxylate |
| SMILES | CC(C)c1cccc(C(C)C2CC2)c1OCOC(=O)C1CCNC1 |
| InChI | InChI=1S/C20H29NO3/c1-13(2)17-5-4-6-18(14(3)15-7-8-15)19(17)23-12-24-20(22)16-9-10-21-11-16/h4-6,13-16,21H,7-12H2,1-3H3 |
| InChIKey | BVZMSCSUULOTER-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|