C17H25NO5 — CID 11267266
2-amino-4-[[2,6-di(propan-2-yl)phenoxy]methoxy]-4-oxobutanoic acid (PubChem CID 11267266) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-amino-4-[[2,6-di(propan-2-yl)phenoxy]methoxy]-4-oxobutanoic acid.
| Compound Name | 2-amino-4-[[2,6-di(propan-2-yl)phenoxy]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 11267266 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-amino-4-[[2,6-di(propan-2-yl)phenoxy]methoxy]-4-oxobutanoic acid |
| SMILES | CC(C)c1cccc(C(C)C)c1OCOC(=O)CC(N)C(=O)O |
| InChI | InChI=1S/C17H25NO5/c1-10(2)12-6-5-7-13(11(3)4)16(12)23-9-22-15(19)8-14(18)17(20)21/h5-7,10-11,14H,8-9,18H2,1-4H3,(H,20,21) |
| InChIKey | ICNVHVMABWZFFQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|