C21H34N2O4 — CID 11610561
[2,6-di(propan-2-yl)phenyl] 4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3,3-dimethylbutanoate (PubChem CID 11610561) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] 4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3,3-dimethylbutanoate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] 4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 11610561 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] 4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3,3-dimethylbutanoate |
| SMILES | CC(C)c1cccc(C(C)C)c1OC(=O)CC(C)(C)CNC(=O)[C@@H](N)CO |
| InChI | InChI=1S/C21H34N2O4/c1-13(2)15-8-7-9-16(14(3)4)19(15)27-18(25)10-21(5,6)12-23-20(26)17(22)11-24/h7-9,13-14,17,24H,10-12,22H2,1-6H3,(H,23,26)/t17-/m0/s1 |
| InChIKey | KIWORCNBVONOJD-KRWDZBQOSA-N |
| XLogP | 2.69 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|