C26H35NO4 — CID 68535895
[2,6-di(propan-2-yl)phenyl] 3,3-dimethyl-4-(phenylmethoxycarbonylamino)butanoate (PubChem CID 68535895) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] 3,3-dimethyl-4-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] 3,3-dimethyl-4-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 68535895 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] 3,3-dimethyl-4-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)c1cccc(C(C)C)c1OC(=O)CC(C)(C)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H35NO4/c1-18(2)21-13-10-14-22(19(3)4)24(21)31-23(28)15-26(5,6)17-27-25(29)30-16-20-11-8-7-9-12-20/h7-14,18-19H,15-17H2,1-6H3,(H,27,29) |
| InChIKey | NCBASAGFQMVTGH-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|