C27H43F3N2O5 — CID 91148601
[2,6-di(propan-2-yl)phenyl] 4-[[(2S)-2-aminoheptanoyl]amino]-3,3-dimethylbutanoate;2,2,2-trifluoroacetic acid (PubChem CID 91148601) has the molecular formula C27H43F3N2O5 and a molecular weight of 532.64 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] 4-[[(2S)-2-aminoheptanoyl]amino]-3,3-dimethylbutanoate;2,2,2-trifluoroacetic acid.
| Compound Name | [2,6-di(propan-2-yl)phenyl] 4-[[(2S)-2-aminoheptanoyl]amino]-3,3-dimethylbutanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 91148601 |
| Molecular Formula | C27H43F3N2O5 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] 4-[[(2S)-2-aminoheptanoyl]amino]-3,3-dimethylbutanoate;2,2,2-trifluoroacetic acid |
| SMILES | CCCCC[C@H](N)C(=O)NCC(C)(C)CC(=O)Oc1c(C(C)C)cccc1C(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H42N2O3.C2HF3O2/c1-8-9-10-14-21(26)24(29)27-16-25(6,7)15-22(28)30-23-19(17(2)3)12-11-13-20(23)18(4)5;3-2(4,5)1(6)7/h11-13,17-18,21H,8-10,14-16,26H2,1-7H3,(H,27,29);(H,6,7)/t21-;/m0./s1 |
| InChIKey | UKLNFSIQMKEQBY-BOXHHOBZSA-N |
| XLogP | 5.91 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|