C26H44N2O3 — CID 11464640
[2,6-di(propan-2-yl)phenyl] 4-[2-(dibutylamino)ethylamino]-4-oxobutanoate (PubChem CID 11464640) has the molecular formula C26H44N2O3 and a molecular weight of 432.65 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] 4-[2-(dibutylamino)ethylamino]-4-oxobutanoate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] 4-[2-(dibutylamino)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 11464640 |
| Molecular Formula | C26H44N2O3 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] 4-[2-(dibutylamino)ethylamino]-4-oxobutanoate |
| SMILES | CCCCN(CCCC)CCNC(=O)CCC(=O)Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C26H44N2O3/c1-7-9-17-28(18-10-8-2)19-16-27-24(29)14-15-25(30)31-26-22(20(3)4)12-11-13-23(26)21(5)6/h11-13,20-21H,7-10,14-19H2,1-6H3,(H,27,29) |
| InChIKey | KZPVJEICWROJRE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|